CAS 2223104-27-4 is the registry number for 4-Vinylbenzene-1,2,3-triyl triacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,3-diacetyloxy-4-ethenylphenyl) acetate (CAS 2223104-27-4) is a chemical compound with the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. IUPAC name: (2,3-diacetyloxy-4-ethenylphenyl) acetate. InChIKey: ZSIXCYXJGOJILP-UHFFFAOYSA-N.
| Molecular formula | C14H14O6 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | (2,3-diacetyloxy-4-ethenylphenyl) acetate |
| InChIKey | ZSIXCYXJGOJILP-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C(=C(C=C1)C=C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)