Products 1800008-77-8
CAS 1800008-77-8 appears in our catalog under these names: 3–O–Debenzoylzeylenone, 3-O-Debenzoylzeylenone. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
[(1S,5R,6S)-1,5,6-trihydroxy-2-oxocyclohex-3-en-1-yl]methyl benzoate (CAS 1800008-77-8) is a chemical compound with the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. IUPAC name: [(1S,5R,6S)-1,5,6-trihydroxy-2-oxocyclohex-3-en-1-yl]methyl benzoate. InChIKey: ISGGRGRMTBVSEN-SCDSUCTJSA-N.
| Molecular formula | C14H14O6 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | [(1S,5R,6S)-1,5,6-trihydroxy-2-oxocyclohex-3-en-1-yl]methyl benzoate |
| InChIKey | ISGGRGRMTBVSEN-SCDSUCTJSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@]2([C@H]([C@@H](C=CC2=O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
3-O-Debenzoylzeylenone, orb1680605