CAS 1294496-58-4 appears in our catalog under these names: 2-chloro-5-((2,2-dimethylpropanoylamino)-methyl)-benzoic acid, 2-Chloro-5-(pivalamidomethyl)benzoic acid, 97%, 97%, 2-CHLORO-5-[(2,2-DIMETHYLPROPANOYLAMINO)-METHYL]-BENZOIC ACID, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 500mg, 1g, 5g, 2.5g.
2-chloro-5-[(2,2-dimethylpropanoylamino)methyl]benzoic acid (CAS 1294496-58-4) is a chemical compound with the molecular formula C13H16ClNO3 and a molecular weight of 269.72 g/mol. IUPAC name: 2-chloro-5-[(2,2-dimethylpropanoylamino)methyl]benzoic acid. InChIKey: XYNJWVZKEHCRHZ-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO3 |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 2-chloro-5-[(2,2-dimethylpropanoylamino)methyl]benzoic acid |
| InChIKey | XYNJWVZKEHCRHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NCC1=CC(=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)