CAS 129488-75-1 appears in our catalog under these names: 4-(2-Cyanopropan-2-yl)benzoyl chloride, 97%, 4-(2-Cyano-2-propyl)benzoyl Chloride, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
4-(2-cyanopropan-2-yl)benzoyl chloride (CAS 129488-75-1) is a chemical compound with the molecular formula C11H10ClNO and a molecular weight of 207.65 g/mol. IUPAC name: 4-(2-cyanopropan-2-yl)benzoyl chloride. InChIKey: PSOGCRTXEAQODD-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 4-(2-cyanopropan-2-yl)benzoyl chloride |
| InChIKey | PSOGCRTXEAQODD-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC=C(C=C1)C(=O)Cl |
Computed by PubChem (NCBI)