Products 129570-44-1
CAS 129570-44-1 is the registry number for (1R,4R,7S)-2-Oxa-5-azabicyclo(2.2.1)heptan-7-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R,4R,7S)-2-oxa-5-azabicyclo[2.2.1]heptan-7-ol;hydrochloride (CAS 129570-44-1) is a chemical compound with the molecular formula C5H10ClNO2 and a molecular weight of 151.59 g/mol. IUPAC name: (1R,4R,7S)-2-oxa-5-azabicyclo[2.2.1]heptan-7-ol;hydrochloride. InChIKey: VVHOTOLRKBLIOE-ZDQHTEEMSA-N.
| Molecular formula | C5H10ClNO2 |
|---|---|
| Molecular weight | 151.59 g/mol |
| IUPAC name | (1R,4R,7S)-2-oxa-5-azabicyclo[2.2.1]heptan-7-ol;hydrochloride |
| InChIKey | VVHOTOLRKBLIOE-ZDQHTEEMSA-N |
| SMILES | C1[C@@H]2[C@H]([C@H](N1)CO2)O.Cl |
Computed by PubChem (NCBI)