Products 2247087-94-9
CAS 2247087-94-9 is the registry number for (1S,4S,7R)-2-Oxa-5-azabicyclo(2.2.1)heptan-7-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 100mg, 250mg, 1000mg, 500mg.
(1S,4S,7R)-2-oxa-5-azabicyclo[2.2.1]heptan-7-ol;hydrochloride (CAS 2247087-94-9) is a chemical compound with the molecular formula C5H10ClNO2 and a molecular weight of 151.59 g/mol. IUPAC name: (1S,4S,7R)-2-oxa-5-azabicyclo[2.2.1]heptan-7-ol;hydrochloride. InChIKey: VVHOTOLRKBLIOE-ASMLCRKRSA-N.
| Molecular formula | C5H10ClNO2 |
|---|---|
| Molecular weight | 151.59 g/mol |
| IUPAC name | (1S,4S,7R)-2-oxa-5-azabicyclo[2.2.1]heptan-7-ol;hydrochloride |
| InChIKey | VVHOTOLRKBLIOE-ASMLCRKRSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](N1)CO2)O.Cl |
Computed by PubChem (NCBI)