CAS 129704-13-8 appears in our catalog under these names: (S)–(–)–2–Amino–1,1,2–triphenylethanol, (S)-2-AMino-1,1,2-triphenylethanol, 97%, 97%, (S)-2-amino-1,1,2-triphenylethan-1-ol, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
(2S)-2-amino-1,1,2-triphenylethanol (CAS 129704-13-8) is a chemical compound with the molecular formula C20H19NO and a molecular weight of 289.4 g/mol. IUPAC name: (2S)-2-amino-1,1,2-triphenylethanol. InChIKey: ZQNFUXDRYQQYAQ-IBGZPJMESA-N.
| Molecular formula | C20H19NO |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | (2S)-2-amino-1,1,2-triphenylethanol |
| InChIKey | ZQNFUXDRYQQYAQ-IBGZPJMESA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(C2=CC=CC=C2)(C3=CC=CC=C3)O)N |
Computed by PubChem (NCBI)