Products 612069-10-0

CAS 612069-10-0 is the registry number for Benzyl (4-m-tolyoxyphenyl)amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

N-benzyl-4-(3-methylphenoxy)aniline (CAS 612069-10-0) is a chemical compound with the molecular formula C20H19NO and a molecular weight of 289.4 g/mol. IUPAC name: N-benzyl-4-(3-methylphenoxy)aniline. InChIKey: VGUNYCARBNMOOC-UHFFFAOYSA-N.

Identity
Molecular formulaC20H19NO
Molecular weight289.4 g/mol
IUPAC nameN-benzyl-4-(3-methylphenoxy)aniline
InChIKeyVGUNYCARBNMOOC-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)OC2=CC=C(C=C2)NCC3=CC=CC=C3

Computed by PubChem (NCBI)