CAS 2489182-82-1 appears in our catalog under these names: (S)-2-([1,1':3',1''-Terphenyl]-5'-yl)-2-aminoethan-1-ol, 98%, (S)-2-([1,1':3',1''-Terphenyl]-5'-yl)-2-aminoethan-1-ol, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
(2S)-2-amino-2-(3,5-diphenylphenyl)ethanol (CAS 2489182-82-1) is a chemical compound with the molecular formula C20H19NO and a molecular weight of 289.4 g/mol. IUPAC name: (2S)-2-amino-2-(3,5-diphenylphenyl)ethanol. InChIKey: UJUXIWRXQDZNRU-HXUWFJFHSA-N.
| Molecular formula | C20H19NO |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | (2S)-2-amino-2-(3,5-diphenylphenyl)ethanol |
| InChIKey | UJUXIWRXQDZNRU-HXUWFJFHSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)[C@@H](CO)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)