Products 1297271-50-1
CAS 1297271-50-1 is the registry number for Decanoyl-10,10,10,d3-L-carnitine Chloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
[(2R)-3-carboxy-2-(10,10,10-trideuteriodecanoyloxy)propyl]-trimethylazanium chloride (CAS 1297271-50-1) is a chemical compound with the molecular formula C17H34ClNO4 and a molecular weight of 354.9 g/mol. IUPAC name: [(2R)-3-carboxy-2-(10,10,10-trideuteriodecanoyloxy)propyl]-trimethylazanium chloride. InChIKey: KETNUEKCBCWXCU-QNYOVWSSSA-N.
| Molecular formula | C17H34ClNO4 |
|---|---|
| Molecular weight | 354.9 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-(10,10,10-trideuteriodecanoyloxy)propyl]-trimethylazanium chloride |
| InChIKey | KETNUEKCBCWXCU-QNYOVWSSSA-N |
| SMILES | [2H]C([2H])([2H])CCCCCCCCC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)