CAS 18822-87-2 appears in our catalog under these names: Decanoyl-DL-carnitine chloride, min. 95 %, 2 g, Decanoyl-l-carnitine chloride, 95%, (+/-)-Decanoylcarnitine Chloride, (+/–)–Decanoylcarnitine chloride, Decanoyl-DL-carnitine chloride. Offered by: Roth, Combi-blocks, TRC, GLPBio, Biosynth. Available pack sizes: 2g, 100mg, 250mg, 25mg, 50mg, 0,5g, 0,25g, 1g.
(3-carboxy-2-decanoyloxypropyl)-trimethylazanium chloride (CAS 18822-87-2) is a chemical compound with the molecular formula C17H34ClNO4 and a molecular weight of 351.9 g/mol. IUPAC name: (3-carboxy-2-decanoyloxypropyl)-trimethylazanium chloride. InChIKey: KETNUEKCBCWXCU-UHFFFAOYSA-N.
| Molecular formula | C17H34ClNO4 |
|---|---|
| Molecular weight | 351.9 g/mol |
| IUPAC name | (3-carboxy-2-decanoyloxypropyl)-trimethylazanium chloride |
| InChIKey | KETNUEKCBCWXCU-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OC(CC(=O)O)C[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)