Products 2847775-92-0
CAS 2847775-92-0 appears in our catalog under these names: C10:0 L-CARNITINE-D9 (HCL SALT), Decanoyl–L–carnitine–d9 (chloride), Decanoyl-L-carnitine-d9 (chloride). Offered by: Sigma-Aldrich, GLPBio, MedChemExpress. Available pack sizes: 1MG, 5mg, 5 mg, 1 mg.
[(2S)-3-carboxy-2-decanoyloxypropyl]-tris(trideuteriomethyl)azanium chloride (CAS 2847775-92-0) is a chemical compound with the molecular formula C17H34ClNO4 and a molecular weight of 361.0 g/mol. IUPAC name: [(2S)-3-carboxy-2-decanoyloxypropyl]-tris(trideuteriomethyl)azanium chloride. InChIKey: KETNUEKCBCWXCU-CCPSEARISA-N.
| Molecular formula | C17H34ClNO4 |
|---|---|
| Molecular weight | 361.0 g/mol |
| IUPAC name | [(2S)-3-carboxy-2-decanoyloxypropyl]-tris(trideuteriomethyl)azanium chloride |
| InChIKey | KETNUEKCBCWXCU-CCPSEARISA-N |
| SMILES | [2H]C([2H])([2H])[N+](C[C@H](CC(=O)O)OC(=O)CCCCCCCCC)(C([2H])([2H])[2H])C([2H])([2H])[2H].[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Decanoyl L-carnitine-d9 (HCl salt)