CAS 1297611-70-1 is the registry number for ethyl 5-(chlorosulfonyl)-1h-pyrazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Ethyl 5-chlorosulfonyl-1H-pyrazole-3-carboxylate (CAS 1297611-70-1) is a chemical compound with the molecular formula C6H7ClN2O4S and a molecular weight of 238.65 g/mol. IUPAC name: ethyl 5-chlorosulfonyl-1H-pyrazole-3-carboxylate. InChIKey: AQSLQVMVVMEJMB-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O4S |
|---|---|
| Molecular weight | 238.65 g/mol |
| IUPAC name | ethyl 5-chlorosulfonyl-1H-pyrazole-3-carboxylate |
| InChIKey | AQSLQVMVVMEJMB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NNC(=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)