Products 1346270-23-2

CAS 1346270-23-2 is the registry number for Methyl 5-(chlorosulfonyl)-3-methyl-1H-pyrazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-chlorosulfonyl-5-methyl-1H-pyrazole-4-carboxylate (CAS 1346270-23-2) is a chemical compound with the molecular formula C6H7ClN2O4S and a molecular weight of 238.65 g/mol. IUPAC name: methyl 3-chlorosulfonyl-5-methyl-1H-pyrazole-4-carboxylate. InChIKey: YVQPLHRRAPOQAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClN2O4S
Molecular weight238.65 g/mol
IUPAC namemethyl 3-chlorosulfonyl-5-methyl-1H-pyrazole-4-carboxylate
InChIKeyYVQPLHRRAPOQAZ-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1)S(=O)(=O)Cl)C(=O)OC

Computed by PubChem (NCBI)