CAS 2228869-05-2 is the registry number for Methyl 4-(chlorosulfonyl)-1-methyl-1H-pyrazole-3-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 4-chlorosulfonyl-1-methylpyrazole-3-carboxylate (CAS 2228869-05-2) is a chemical compound with the molecular formula C6H7ClN2O4S and a molecular weight of 238.65 g/mol. IUPAC name: methyl 4-chlorosulfonyl-1-methylpyrazole-3-carboxylate. InChIKey: QFOIBEHWMRVIQM-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O4S |
|---|---|
| Molecular weight | 238.65 g/mol |
| IUPAC name | methyl 4-chlorosulfonyl-1-methylpyrazole-3-carboxylate |
| InChIKey | QFOIBEHWMRVIQM-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(=O)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)