CAS 129765-95-3 appears in our catalog under these names: 3-(tert-Butoxycarbonylamino)-3-methylbutanoic acid, 95%, N–Boc–3–amino–3–methylbutanoic Acid, Boc-3-amino-3-methyl-butyric acid, 3-((tert-Butoxycarbonyl)amino)-3-methylbutanoic acid, 3-(tert-Butoxycarbonylamino)-3-methylbutanoic acid, 97%, 97%. Offered by: Fluorochem, GLPBio, Iris Biotech, Biosynth, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 2g, 250mg, 100mg.
3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 129765-95-3) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: 3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LHJVMOIOTPJSLS-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LHJVMOIOTPJSLS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)CC(=O)O |
Computed by PubChem (NCBI)