Products 1298094-30-0

CAS 1298094-30-0 is the registry number for 2,2,2-Trifluoro-1-(piperidin-4-yl)ethanol oxalate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Oxalic acid;2,2,2-trifluoro-1-piperidin-4-ylethanol (CAS 1298094-30-0) is a chemical compound with the molecular formula C9H14F3NO5 and a molecular weight of 273.21 g/mol. IUPAC name: oxalic acid;2,2,2-trifluoro-1-piperidin-4-ylethanol. InChIKey: WGCRIBLVYFBLRI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14F3NO5
Molecular weight273.21 g/mol
IUPAC nameoxalic acid;2,2,2-trifluoro-1-piperidin-4-ylethanol
InChIKeyWGCRIBLVYFBLRI-UHFFFAOYSA-N
SMILESC1CNCCC1C(C(F)(F)F)O.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)