CAS 1298094-30-0 is the registry number for 2,2,2-Trifluoro-1-(piperidin-4-yl)ethanol oxalate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 100mg.
Oxalic acid;2,2,2-trifluoro-1-piperidin-4-ylethanol (CAS 1298094-30-0) is a chemical compound with the molecular formula C9H14F3NO5 and a molecular weight of 273.21 g/mol. IUPAC name: oxalic acid;2,2,2-trifluoro-1-piperidin-4-ylethanol. InChIKey: WGCRIBLVYFBLRI-UHFFFAOYSA-N.
| Molecular formula | C9H14F3NO5 |
|---|---|
| Molecular weight | 273.21 g/mol |
| IUPAC name | oxalic acid;2,2,2-trifluoro-1-piperidin-4-ylethanol |
| InChIKey | WGCRIBLVYFBLRI-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(C(F)(F)F)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)