CAS 1334417-63-8 is the registry number for 4-(1-Hydroxy-2,2,2-trifluoroethyl)piperidine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Oxalic acid;2,2,2-trifluoro-1-piperidin-4-ylethanol (CAS 1334417-63-8) is a chemical compound with the molecular formula C9H14F3NO5 and a molecular weight of 273.21 g/mol. IUPAC name: oxalic acid;2,2,2-trifluoro-1-piperidin-4-ylethanol. InChIKey: WGCRIBLVYFBLRI-UHFFFAOYSA-N.
| Molecular formula | C9H14F3NO5 |
|---|---|
| Molecular weight | 273.21 g/mol |
| IUPAC name | oxalic acid;2,2,2-trifluoro-1-piperidin-4-ylethanol |
| InChIKey | WGCRIBLVYFBLRI-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(C(F)(F)F)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)