CAS 920314-22-3 is the registry number for Boc-L-TfThr-OH (2S,3S). Offered by: Iris Biotech. Available pack sizes: on request.
(2S,3S)-4,4,4-trifluoro-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 920314-22-3) is a chemical compound with the molecular formula C9H14F3NO5 and a molecular weight of 273.21 g/mol. IUPAC name: (2S,3S)-4,4,4-trifluoro-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: GZYYVNMZOFVOCW-WHFBIAKZSA-N.
| Molecular formula | C9H14F3NO5 |
|---|---|
| Molecular weight | 273.21 g/mol |
| IUPAC name | (2S,3S)-4,4,4-trifluoro-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | GZYYVNMZOFVOCW-WHFBIAKZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]([C@@H](C(F)(F)F)O)C(=O)O |
Computed by PubChem (NCBI)