CAS 129821-08-5 is the registry number for 3-ATA. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, Get quote.
3-amino-10H-acridine-9-thione (CAS 129821-08-5) is a chemical compound with the molecular formula C13H10N2S and a molecular weight of 226.30 g/mol. IUPAC name: 3-amino-10H-acridine-9-thione. InChIKey: LHMSGVQQFOFVAP-UHFFFAOYSA-N.
| Molecular formula | C13H10N2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 3-amino-10H-acridine-9-thione |
| InChIKey | LHMSGVQQFOFVAP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=S)C3=C(N2)C=C(C=C3)N |
Computed by PubChem (NCBI)