Products 129848-87-9
CAS 129848-87-9 appears in our catalog under these names: Propio-2,2-d2-phenone, 98 atom % D, min 98% Chemical Purity, Propio-2,2-d2-phenone. Offered by: CDN, Biosynth. Available pack sizes: 5g, 1g, 5000mg, 1000mg.
2,2-dideuterio-1-phenylpropan-1-one (CAS 129848-87-9) is a chemical compound with the molecular formula C9H10O and a molecular weight of 136.19 g/mol. IUPAC name: 2,2-dideuterio-1-phenylpropan-1-one. InChIKey: KRIOVPPHQSLHCZ-CBTSVUPCSA-N.
| Molecular formula | C9H10O |
|---|---|
| Molecular weight | 136.19 g/mol |
| IUPAC name | 2,2-dideuterio-1-phenylpropan-1-one |
| InChIKey | KRIOVPPHQSLHCZ-CBTSVUPCSA-N |
| SMILES | [2H]C([2H])(C)C(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)