Products 342610-99-5
CAS 342610-99-5 appears in our catalog under these names: Propio-d5-phenone, 98 atom % D, min 98% Chemical Purity, Propio-d5-phenone. Offered by: CDN, Biosynth. Available pack sizes: 1g, 0,5g, 250mg, 500mg.
2,2,3,3,3-pentadeuterio-1-phenylpropan-1-one (CAS 342610-99-5) is a chemical compound with the molecular formula C9H10O and a molecular weight of 139.21 g/mol. IUPAC name: 2,2,3,3,3-pentadeuterio-1-phenylpropan-1-one. InChIKey: KRIOVPPHQSLHCZ-ZBJDZAJPSA-N.
| Molecular formula | C9H10O |
|---|---|
| Molecular weight | 139.21 g/mol |
| IUPAC name | 2,2,3,3,3-pentadeuterio-1-phenylpropan-1-one |
| InChIKey | KRIOVPPHQSLHCZ-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)