Products 288400-96-4
CAS 288400-96-4 appears in our catalog under these names: Propiophenone-d10, 98 atom % D, min 98% Chemical Purity, Propiophenone-d10. Offered by: CDN, Biosynth. Available pack sizes: 1g, 0,5g, 500mg, 250mg.
2,2,3,3,3-pentadeuterio-1-(2,3,4,5,6-pentadeuteriophenyl)propan-1-one (CAS 288400-96-4) is a chemical compound with the molecular formula C9H10O and a molecular weight of 144.24 g/mol. IUPAC name: 2,2,3,3,3-pentadeuterio-1-(2,3,4,5,6-pentadeuteriophenyl)propan-1-one. InChIKey: KRIOVPPHQSLHCZ-CFTAVCBPSA-N.
| Molecular formula | C9H10O |
|---|---|
| Molecular weight | 144.24 g/mol |
| IUPAC name | 2,2,3,3,3-pentadeuterio-1-(2,3,4,5,6-pentadeuteriophenyl)propan-1-one |
| InChIKey | KRIOVPPHQSLHCZ-CFTAVCBPSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C([2H])([2H])C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)