CAS 129939-67-9 is the registry number for rel-Benzyl (2R,3aR,6aR)-octahydrocyclopenta[b]pyrrole-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate (CAS 129939-67-9) is a chemical compound with the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. IUPAC name: benzyl (2S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate. InChIKey: KEDWLCOPRDSQBB-IHRRRGAJSA-N.
| Molecular formula | C15H19NO2 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | benzyl (2S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate |
| InChIKey | KEDWLCOPRDSQBB-IHRRRGAJSA-N |
| SMILES | C1C[C@H]2C[C@H](N[C@H]2C1)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)