Products 129944-99-6
CAS 129944-99-6 is the registry number for meta-Hydroxybenzoylecgonine. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
(1R,2R,3S,5S)-3-(3-hydroxybenzoyl)oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid (CAS 129944-99-6) is a chemical compound with the molecular formula C16H19NO5 and a molecular weight of 305.32 g/mol. IUPAC name: (1R,2R,3S,5S)-3-(3-hydroxybenzoyl)oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid. InChIKey: XCJJCRPRQYXLRE-AHLTXXRQSA-N.
| Molecular formula | C16H19NO5 |
|---|---|
| Molecular weight | 305.32 g/mol |
| IUPAC name | (1R,2R,3S,5S)-3-(3-hydroxybenzoyl)oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid |
| InChIKey | XCJJCRPRQYXLRE-AHLTXXRQSA-N |
| SMILES | CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)OC(=O)C3=CC(=CC=C3)O)C(=O)O |
Computed by PubChem (NCBI)