Products 1299607-52-5
CAS 1299607-52-5 is the registry number for [3-(4-Amino-phenyl)-5-trifluoromethyl-pyridin-2-yl]-dimethyl-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(4-aminophenyl)-N,N-dimethyl-5-(trifluoromethyl)pyridin-2-amine (CAS 1299607-52-5) is a chemical compound with the molecular formula C14H14F3N3 and a molecular weight of 281.28 g/mol. IUPAC name: 3-(4-aminophenyl)-N,N-dimethyl-5-(trifluoromethyl)pyridin-2-amine. InChIKey: DYBURNZKVPPRRR-UHFFFAOYSA-N.
| Molecular formula | C14H14F3N3 |
|---|---|
| Molecular weight | 281.28 g/mol |
| IUPAC name | 3-(4-aminophenyl)-N,N-dimethyl-5-(trifluoromethyl)pyridin-2-amine |
| InChIKey | DYBURNZKVPPRRR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=N1)C(F)(F)F)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)