CAS 353457-63-3 is the registry number for 4-(3-(Trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-1-yl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]aniline (CAS 353457-63-3) is a chemical compound with the molecular formula C14H14F3N3 and a molecular weight of 281.28 g/mol. IUPAC name: 4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]aniline. InChIKey: FYBFJLPKLVNBDJ-UHFFFAOYSA-N.
| Molecular formula | C14H14F3N3 |
|---|---|
| Molecular weight | 281.28 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]aniline |
| InChIKey | FYBFJLPKLVNBDJ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2C3=CC=C(C=C3)N)C(F)(F)F |
Computed by PubChem (NCBI)