CAS 937607-82-4 appears in our catalog under these names: 2-(3-(Trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-1-yl)aniline, 98%, 2-(3-(Trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-1-yl)aniline. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]aniline (CAS 937607-82-4) is a chemical compound with the molecular formula C14H14F3N3 and a molecular weight of 281.28 g/mol. IUPAC name: 2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]aniline. InChIKey: LXFARZYALKSMST-UHFFFAOYSA-N.
| Molecular formula | C14H14F3N3 |
|---|---|
| Molecular weight | 281.28 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]aniline |
| InChIKey | LXFARZYALKSMST-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2C3=CC=CC=C3N)C(F)(F)F |
Computed by PubChem (NCBI)