CAS 143767-20-8 is the registry number for 3-Isopropyl,5-tert-butylpyrocatechol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-tert-butyl-3-propan-2-ylbenzene-1,2-diol (CAS 143767-20-8) is a chemical compound with the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. IUPAC name: 5-tert-butyl-3-propan-2-ylbenzene-1,2-diol. InChIKey: KOZBQTMIPJSXCY-UHFFFAOYSA-N.
| Molecular formula | C13H20O2 |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | 5-tert-butyl-3-propan-2-ylbenzene-1,2-diol |
| InChIKey | KOZBQTMIPJSXCY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC(=C1)C(C)(C)C)O)O |
Computed by PubChem (NCBI)