CAS 37845-05-9 appears in our catalog under these names: 3-Ethyladamantane-1-carboxylic acid, 97%, 3-ethyladamantane-1-carboxylic Acid. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 5g, 1g, 100mg, 10mg, 50mg.
3-ethyladamantane-1-carboxylic acid (CAS 37845-05-9) is a chemical compound with the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. IUPAC name: 3-ethyladamantane-1-carboxylic acid. InChIKey: ZJBLNYRNJSFPQO-UHFFFAOYSA-N.
| Molecular formula | C13H20O2 |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | 3-ethyladamantane-1-carboxylic acid |
| InChIKey | ZJBLNYRNJSFPQO-UHFFFAOYSA-N |
| SMILES | CCC12CC3CC(C1)CC(C3)(C2)C(=O)O |
Computed by PubChem (NCBI)