CAS 129972-90-3 is the registry number for 3-(3-Nitrophenyl)-1-phenyl-2-propyn-1-one, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
3-(3-nitrophenyl)-1-phenylprop-2-yn-1-one (CAS 129972-90-3) is a chemical compound with the molecular formula C15H9NO3 and a molecular weight of 251.24 g/mol. IUPAC name: 3-(3-nitrophenyl)-1-phenylprop-2-yn-1-one. InChIKey: PPFBVVKWYQVYKJ-UHFFFAOYSA-N.
| Molecular formula | C15H9NO3 |
|---|---|
| Molecular weight | 251.24 g/mol |
| IUPAC name | 3-(3-nitrophenyl)-1-phenylprop-2-yn-1-one |
| InChIKey | PPFBVVKWYQVYKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C#CC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)