CAS 205759-45-1 is the registry number for 3-(1,3-Dioxoisoindol-2-yl)benzaldehyde, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(1,3-dioxoisoindol-2-yl)benzaldehyde (CAS 205759-45-1) is a chemical compound with the molecular formula C15H9NO3 and a molecular weight of 251.24 g/mol. IUPAC name: 3-(1,3-dioxoisoindol-2-yl)benzaldehyde. InChIKey: JCSWOUPBYICMPS-UHFFFAOYSA-N.
| Molecular formula | C15H9NO3 |
|---|---|
| Molecular weight | 251.24 g/mol |
| IUPAC name | 3-(1,3-dioxoisoindol-2-yl)benzaldehyde |
| InChIKey | JCSWOUPBYICMPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=CC(=C3)C=O |
Computed by PubChem (NCBI)