CAS 70803-94-0 is the registry number for 7-Benzoyl-1H-indole-2,3-dione. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
7-benzoyl-1H-indole-2,3-dione (CAS 70803-94-0) is a chemical compound with the molecular formula C15H9NO3 and a molecular weight of 251.24 g/mol. IUPAC name: 7-benzoyl-1H-indole-2,3-dione. InChIKey: DCLKAUIECUBKDF-UHFFFAOYSA-N.
| Molecular formula | C15H9NO3 |
|---|---|
| Molecular weight | 251.24 g/mol |
| IUPAC name | 7-benzoyl-1H-indole-2,3-dione |
| InChIKey | DCLKAUIECUBKDF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC3=C2NC(=O)C3=O |
Computed by PubChem (NCBI)