CAS 129973-74-6 is the registry number for 5'-Chloro-2'-nitro-N-phenyl-malonanilic Acid-d5 Ethyl Ester. Offered by: TRC. Available pack sizes: 50mg, 5mg.
Ethyl 3-(5-chloro-2-nitro-N-(2,3,4,5,6-pentadeuteriophenyl)anilino)-3-oxopropanoate (CAS 129973-74-6) is a chemical compound with the molecular formula C17H15ClN2O5 and a molecular weight of 367.8 g/mol. IUPAC name: ethyl 3-(5-chloro-2-nitro-N-(2,3,4,5,6-pentadeuteriophenyl)anilino)-3-oxopropanoate. InChIKey: ZRYOWWCGEBQSKY-DKFMXDSJSA-N.
| Molecular formula | C17H15ClN2O5 |
|---|---|
| Molecular weight | 367.8 g/mol |
| IUPAC name | ethyl 3-(5-chloro-2-nitro-N-(2,3,4,5,6-pentadeuteriophenyl)anilino)-3-oxopropanoate |
| InChIKey | ZRYOWWCGEBQSKY-DKFMXDSJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N(C2=C(C=CC(=C2)Cl)[N+](=O)[O-])C(=O)CC(=O)OCC)[2H])[2H] |
Computed by PubChem (NCBI)