Products 22316-45-6

CAS 22316-45-6 is the registry number for 5'-Chloro-2'-nitro-N-phenyl-malonanilic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 3-(N-(5-chloro-2-nitrophenyl)anilino)-3-oxopropanoate (CAS 22316-45-6) is a chemical compound with the molecular formula C17H15ClN2O5 and a molecular weight of 362.8 g/mol. IUPAC name: ethyl 3-(N-(5-chloro-2-nitrophenyl)anilino)-3-oxopropanoate. InChIKey: ZRYOWWCGEBQSKY-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15ClN2O5
Molecular weight362.8 g/mol
IUPAC nameethyl 3-(N-(5-chloro-2-nitrophenyl)anilino)-3-oxopropanoate
InChIKeyZRYOWWCGEBQSKY-UHFFFAOYSA-N
SMILESCCOC(=O)CC(=O)N(C1=CC=CC=C1)C2=C(C=CC(=C2)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)