CAS 849616-57-5 is the registry number for GDI-5755. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-chlorophenyl) 4-morpholin-4-yl-3-nitrobenzoate (CAS 849616-57-5) is a chemical compound with the molecular formula C17H15ClN2O5 and a molecular weight of 362.8 g/mol. IUPAC name: (4-chlorophenyl) 4-morpholin-4-yl-3-nitrobenzoate. InChIKey: QQLTUKQDXPFTDK-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O5 |
|---|---|
| Molecular weight | 362.8 g/mol |
| IUPAC name | (4-chlorophenyl) 4-morpholin-4-yl-3-nitrobenzoate |
| InChIKey | QQLTUKQDXPFTDK-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)C(=O)OC3=CC=C(C=C3)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)