CAS 1300712-92-8 is the registry number for 1-(4-Chlorophenyl)-N-methyl-5-oxo-2,5-dihydro-1H-1,2,4-triazole-3-carboxamide, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1-(4-chlorophenyl)-N,N-dimethyl-5-oxo-4H-1,2,4-triazole-3-carboxamide (CAS 1300712-92-8) is a chemical compound with the molecular formula C11H11ClN4O2 and a molecular weight of 266.68 g/mol. IUPAC name: 1-(4-chlorophenyl)-N,N-dimethyl-5-oxo-4H-1,2,4-triazole-3-carboxamide. InChIKey: RIYUHJWINQPCAJ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN4O2 |
|---|---|
| Molecular weight | 266.68 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-N,N-dimethyl-5-oxo-4H-1,2,4-triazole-3-carboxamide |
| InChIKey | RIYUHJWINQPCAJ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=NN(C(=O)N1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)