CAS 57653-26-6 appears in our catalog under these names: Fenobam, Fenobam/ 99.93% (existing batch purity), Fenobam 98%, Fenobam, 98%, 98%, Fenobam, 99.91%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 50mg, 1mg, 5mg, 10mg, 25mg, 100mg, 500mg, 10mM (in 1ml dmso).
1-(3-chlorophenyl)-3-(1-methyl-4-oxoimidazolidin-2-ylidene)urea (CAS 57653-26-6) is a chemical compound with the molecular formula C11H11ClN4O2 and a molecular weight of 266.68 g/mol. IUPAC name: 1-(3-chlorophenyl)-3-(1-methyl-4-oxoimidazolidin-2-ylidene)urea. InChIKey: DWPQODZAOSWNHB-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN4O2 |
|---|---|
| Molecular weight | 266.68 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-3-(1-methyl-4-oxoimidazolidin-2-ylidene)urea |
| InChIKey | DWPQODZAOSWNHB-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)NC1=NC(=O)NC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)