CAS 28924-60-9 is the registry number for Ethyl 5-amino-1-(3-chlorophenyl)-1H-1,2,3-triazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-amino-1-(3-chlorophenyl)triazole-4-carboxylate (CAS 28924-60-9) is a chemical compound with the molecular formula C11H11ClN4O2 and a molecular weight of 266.68 g/mol. IUPAC name: ethyl 5-amino-1-(3-chlorophenyl)triazole-4-carboxylate. InChIKey: ZOQWWKJOMSKGRQ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN4O2 |
|---|---|
| Molecular weight | 266.68 g/mol |
| IUPAC name | ethyl 5-amino-1-(3-chlorophenyl)triazole-4-carboxylate |
| InChIKey | ZOQWWKJOMSKGRQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=N1)C2=CC(=CC=C2)Cl)N |
Computed by PubChem (NCBI)