Products 130091-84-8

CAS 130091-84-8 is the registry number for Methyl 3,4-diamino-5-chloro-2-methoxybenzoate. Offered by: Biosynth. Available pack sizes: 250mg, 500mg.

Structural formula: {0} (CAS {1})

Methyl 3,4-diamino-5-chloro-2-methoxybenzoate (CAS 130091-84-8) is a chemical compound with the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. IUPAC name: methyl 3,4-diamino-5-chloro-2-methoxybenzoate. InChIKey: SWPGBWWXQKTEQO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClN2O3
Molecular weight230.65 g/mol
IUPAC namemethyl 3,4-diamino-5-chloro-2-methoxybenzoate
InChIKeySWPGBWWXQKTEQO-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1C(=O)OC)Cl)N)N

Computed by PubChem (NCBI)