CAS 130091-84-8 is the registry number for Methyl 3,4-diamino-5-chloro-2-methoxybenzoate. Offered by: Biosynth. Available pack sizes: 250mg, 500mg.
Methyl 3,4-diamino-5-chloro-2-methoxybenzoate (CAS 130091-84-8) is a chemical compound with the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. IUPAC name: methyl 3,4-diamino-5-chloro-2-methoxybenzoate. InChIKey: SWPGBWWXQKTEQO-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O3 |
|---|---|
| Molecular weight | 230.65 g/mol |
| IUPAC name | methyl 3,4-diamino-5-chloro-2-methoxybenzoate |
| InChIKey | SWPGBWWXQKTEQO-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1C(=O)OC)Cl)N)N |
Computed by PubChem (NCBI)