CAS 130111-08-9 appears in our catalog under these names: 3-(Benzyloxy)-2-hydroxypropanoic acid, 95%, (R)-3-(Benzyloxy)-2-hydroxypropanoic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 100mg, 1g.
(2R)-2-hydroxy-3-phenylmethoxypropanoic acid (CAS 130111-08-9) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: (2R)-2-hydroxy-3-phenylmethoxypropanoic acid. InChIKey: LYSUHDDCSREYHC-SECBINFHSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | (2R)-2-hydroxy-3-phenylmethoxypropanoic acid |
| InChIKey | LYSUHDDCSREYHC-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@H](C(=O)O)O |
Computed by PubChem (NCBI)