Products 130273-87-9
CAS 130273-87-9 appears in our catalog under these names: Bimatoprost isopropyl ester, 15(R)–17–phenyl trinor Prostaglandin F2α isopropyl ester. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 5 mg, 1 mg.
Propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate (CAS 130273-87-9) is a chemical compound with the molecular formula C26H38O5 and a molecular weight of 430.6 g/mol. IUPAC name: propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate. InChIKey: JGZRPRSJSQLFBO-DYZSFVSISA-N.
| Molecular formula | C26H38O5 |
|---|---|
| Molecular weight | 430.6 g/mol |
| IUPAC name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate |
| InChIKey | JGZRPRSJSQLFBO-DYZSFVSISA-N |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@H]1[C@H](C[C@H]([C@@H]1/C=C/[C@@H](CCC2=CC=CC=C2)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Bimatoprost isopropyl ester, orb1698143