CAS 135646-98-9 appears in our catalog under these names: 15-Keto Latanoprost, 15-Keto Latanoprost, >95% (HPLC), 15–keto Latanoprost. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 2mg, 1 mg.
Propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxo-5-phenylpentyl)cyclopentyl]hept-5-enoate (CAS 135646-98-9) is a chemical compound with the molecular formula C26H38O5 and a molecular weight of 430.6 g/mol. IUPAC name: propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxo-5-phenylpentyl)cyclopentyl]hept-5-enoate. InChIKey: DKYCMQSMHPIBBZ-VIZYZFHWSA-N.
| Molecular formula | C26H38O5 |
|---|---|
| Molecular weight | 430.6 g/mol |
| IUPAC name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxo-5-phenylpentyl)cyclopentyl]hept-5-enoate |
| InChIKey | DKYCMQSMHPIBBZ-VIZYZFHWSA-N |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@H]1[C@H](C[C@H]([C@@H]1CCC(=O)CCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)