Products 141074-06-8
CAS 141074-06-8 appears in our catalog under these names: 9–keto Latanoprost, 9-Keto-latanoprost. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 1 mg, 5 mg.
Propan-2-yl (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]-5-oxocyclopentyl]hept-5-enoate (CAS 141074-06-8) is a chemical compound with the molecular formula C26H38O5 and a molecular weight of 430.6 g/mol. IUPAC name: propan-2-yl (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]-5-oxocyclopentyl]hept-5-enoate. InChIKey: ZSGHYOSSOMJHCF-KEMWZPBQSA-N.
| Molecular formula | C26H38O5 |
|---|---|
| Molecular weight | 430.6 g/mol |
| IUPAC name | propan-2-yl (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]-5-oxocyclopentyl]hept-5-enoate |
| InChIKey | ZSGHYOSSOMJHCF-KEMWZPBQSA-N |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@@H]1[C@H]([C@@H](CC1=O)O)CC[C@H](CCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)