CAS 13029-73-7 appears in our catalog under these names: 2-(4-Bromophenylsulfonamido)acetic acid, 98%, 2-(4-Bromophenylsulfonamido)acetic acid, 2-(4-Bromophenylsulfonamido)acetic acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 10g, 100mg, 250mg.
2-[(4-bromophenyl)sulfonylamino]acetic acid (CAS 13029-73-7) is a chemical compound with the molecular formula C8H8BrNO4S and a molecular weight of 294.12 g/mol. IUPAC name: 2-[(4-bromophenyl)sulfonylamino]acetic acid. InChIKey: NDAHRASKKXWZMD-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO4S |
|---|---|
| Molecular weight | 294.12 g/mol |
| IUPAC name | 2-[(4-bromophenyl)sulfonylamino]acetic acid |
| InChIKey | NDAHRASKKXWZMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)NCC(=O)O)Br |
Computed by PubChem (NCBI)