CAS 849035-67-2 appears in our catalog under these names: 1-(Bromomethyl)-4-(methylsulfonyl)-2-nitrobenzene, 95+%, 1-(Bromomethyl)-4-(methylsulfonyl)-2-nitrobenzene, 85%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 5g.
1-(bromomethyl)-4-methylsulfonyl-2-nitrobenzene (CAS 849035-67-2) is a chemical compound with the molecular formula C8H8BrNO4S and a molecular weight of 294.12 g/mol. IUPAC name: 1-(bromomethyl)-4-methylsulfonyl-2-nitrobenzene. InChIKey: ZXOQKCSPENGHOG-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO4S |
|---|---|
| Molecular weight | 294.12 g/mol |
| IUPAC name | 1-(bromomethyl)-4-methylsulfonyl-2-nitrobenzene |
| InChIKey | ZXOQKCSPENGHOG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)