Products 2098699-89-7

CAS 2098699-89-7 is the registry number for 5-Bromo-3-(ethylsulfonyl)picolinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-bromo-3-ethylsulfonylpyridine-2-carboxylic acid (CAS 2098699-89-7) is a chemical compound with the molecular formula C8H8BrNO4S and a molecular weight of 294.12 g/mol. IUPAC name: 5-bromo-3-ethylsulfonylpyridine-2-carboxylic acid. InChIKey: QRHLATVHBDWVEA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrNO4S
Molecular weight294.12 g/mol
IUPAC name5-bromo-3-ethylsulfonylpyridine-2-carboxylic acid
InChIKeyQRHLATVHBDWVEA-UHFFFAOYSA-N
SMILESCCS(=O)(=O)C1=C(N=CC(=C1)Br)C(=O)O

Computed by PubChem (NCBI)