CAS 130291-18-8 is the registry number for 8-chloro-3-(trifluoromethyl)-1,5-naphthyridine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
8-chloro-3-(trifluoromethyl)-1,5-naphthyridine (CAS 130291-18-8) is a chemical compound with the molecular formula C9H4ClF3N2 and a molecular weight of 232.59 g/mol. IUPAC name: 8-chloro-3-(trifluoromethyl)-1,5-naphthyridine. InChIKey: LLDGSGWJLWSYFC-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF3N2 |
|---|---|
| Molecular weight | 232.59 g/mol |
| IUPAC name | 8-chloro-3-(trifluoromethyl)-1,5-naphthyridine |
| InChIKey | LLDGSGWJLWSYFC-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(C=NC2=C1Cl)C(F)(F)F |
Computed by PubChem (NCBI)