CAS 890301-88-9 appears in our catalog under these names: 5-Chloro-2-(trifluoromethyl)-1,6-naphthyridine, 98+%, 5-Chloro-2-(trifluoromethyl)-1,6-naphthyridine, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
5-chloro-2-(trifluoromethyl)-1,6-naphthyridine (CAS 890301-88-9) is a chemical compound with the molecular formula C9H4ClF3N2 and a molecular weight of 232.59 g/mol. IUPAC name: 5-chloro-2-(trifluoromethyl)-1,6-naphthyridine. InChIKey: YLBIPYOXHRQCQD-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF3N2 |
|---|---|
| Molecular weight | 232.59 g/mol |
| IUPAC name | 5-chloro-2-(trifluoromethyl)-1,6-naphthyridine |
| InChIKey | YLBIPYOXHRQCQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=NC=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)