Products 2289644-70-6

CAS 2289644-70-6 is the registry number for N-(3-Cyanophenyl)-2,2,2-trifluoroacetimidoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

N-(3-cyanophenyl)-2,2,2-trifluoroethanimidoyl chloride (CAS 2289644-70-6) is a chemical compound with the molecular formula C9H4ClF3N2 and a molecular weight of 232.59 g/mol. IUPAC name: N-(3-cyanophenyl)-2,2,2-trifluoroethanimidoyl chloride. InChIKey: NOASFVSFHVVVDU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4ClF3N2
Molecular weight232.59 g/mol
IUPAC nameN-(3-cyanophenyl)-2,2,2-trifluoroethanimidoyl chloride
InChIKeyNOASFVSFHVVVDU-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)N=C(C(F)(F)F)Cl)C#N

Computed by PubChem (NCBI)