CAS 2289644-70-6 is the registry number for N-(3-Cyanophenyl)-2,2,2-trifluoroacetimidoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-cyanophenyl)-2,2,2-trifluoroethanimidoyl chloride (CAS 2289644-70-6) is a chemical compound with the molecular formula C9H4ClF3N2 and a molecular weight of 232.59 g/mol. IUPAC name: N-(3-cyanophenyl)-2,2,2-trifluoroethanimidoyl chloride. InChIKey: NOASFVSFHVVVDU-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF3N2 |
|---|---|
| Molecular weight | 232.59 g/mol |
| IUPAC name | N-(3-cyanophenyl)-2,2,2-trifluoroethanimidoyl chloride |
| InChIKey | NOASFVSFHVVVDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N=C(C(F)(F)F)Cl)C#N |
Computed by PubChem (NCBI)